C20H37IN4O3 — CID 111247024
1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111247024) has the molecular formula C20H37IN4O3 and a molecular weight of 508.45 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111247024 |
| Molecular Formula | C20H37IN4O3 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCN(C(C)C)C(C)C)NCc1cc(OC)c(OC)cc1OC.I |
| InChI | InChI=1S/C20H36N4O3.HI/c1-14(2)24(15(3)4)10-9-22-20(21-5)23-13-16-11-18(26-7)19(27-8)12-17(16)25-6;/h11-12,14-15H,9-10,13H2,1-8H3,(H2,21,22,23);1H |
| InChIKey | YRDQIRFWMJWQDM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|