C18H29BrN4O2 — CID 111416815
1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine (PubChem CID 111416815) has the molecular formula C18H29BrN4O2 and a molecular weight of 413.36 g/mol. Its IUPAC name is 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine.
| Compound Name | 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111416815 |
| Molecular Formula | C18H29BrN4O2 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine |
| SMILES | C/N=C(\NCCN1CCCCC1)NCc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C18H29BrN4O2/c1-20-18(21-7-10-23-8-5-4-6-9-23)22-13-14-11-16(24-2)17(25-3)12-15(14)19/h11-12H,4-10,13H2,1-3H3,(H2,20,21,22) |
| InChIKey | YTOYWHOBJDMASP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|