C18H29BrN4O4 — CID 111883831
tert-butyl N-[2-[[N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate (PubChem CID 111883831) has the molecular formula C18H29BrN4O4 and a molecular weight of 445.36 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111883831 |
| Molecular Formula | C18H29BrN4O4 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | tert-butyl N-[2-[[N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C18H29BrN4O4/c1-18(2,3)27-17(24)22-8-7-21-16(20-4)23-11-12-9-14(25-5)15(26-6)10-13(12)19/h9-10H,7-8,11H2,1-6H3,(H,22,24)(H2,20,21,23) |
| InChIKey | NDYWOOIQMYOWSD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|