C16H26BrIN4O2 — CID 111883466
tert-butyl N-[2-[[N-[(3-bromophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111883466) has the molecular formula C16H26BrIN4O2 and a molecular weight of 513.22 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[(3-bromophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-[(3-bromophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111883466 |
| Molecular Formula | C16H26BrIN4O2 |
| Molecular Weight | 513.22 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | tert-butyl N-[2-[[N-[(3-bromophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCc1cccc(Br)c1.I |
| InChI | InChI=1S/C16H25BrN4O2.HI/c1-16(2,3)23-15(22)20-9-8-19-14(18-4)21-11-12-6-5-7-13(17)10-12;/h5-7,10H,8-9,11H2,1-4H3,(H,20,22)(H2,18,19,21);1H |
| InChIKey | HNGJPMVCZIKWQI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|