C17H21BrIN3 — CID 111134372
1-[(3-bromophenyl)methyl]-2-methyl-3-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 111134372) has the molecular formula C17H21BrIN3 and a molecular weight of 474.18 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-2-methyl-3-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3-bromophenyl)methyl]-2-methyl-3-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111134372 |
| Molecular Formula | C17H21BrIN3 |
| Molecular Weight | 474.18 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-2-methyl-3-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccc1)NCc1cccc(Br)c1.I |
| InChI | InChI=1S/C17H20BrN3.HI/c1-19-17(20-11-10-14-6-3-2-4-7-14)21-13-15-8-5-9-16(18)12-15;/h2-9,12H,10-11,13H2,1H3,(H2,19,20,21);1H |
| InChIKey | NARSNVRGRDTFTB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.18 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|