C18H30BrN3O3 — CID 111709493
1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine (PubChem CID 111709493) has the molecular formula C18H30BrN3O3 and a molecular weight of 416.36 g/mol. Its IUPAC name is 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine.
| Compound Name | 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111709493 |
| Molecular Formula | C18H30BrN3O3 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine |
| SMILES | C/N=C(/NCc1cc(OC)c(OC)cc1Br)NCC(OC)C(C)(C)C |
| InChI | InChI=1S/C18H30BrN3O3/c1-18(2,3)16(25-7)11-22-17(20-4)21-10-12-8-14(23-5)15(24-6)9-13(12)19/h8-9,16H,10-11H2,1-7H3,(H2,20,21,22) |
| InChIKey | VVMNKUKRGBAAJL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|