C19H32ClN3O3 — CID 111711285
1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine (PubChem CID 111711285) has the molecular formula C19H32ClN3O3 and a molecular weight of 385.94 g/mol. Its IUPAC name is 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine.
| Compound Name | 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111711285 |
| Molecular Formula | C19H32ClN3O3 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine |
| SMILES | CCOc1c(Cl)cc(CN/C(=N/C)NCC(OC)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C19H32ClN3O3/c1-8-26-17-14(20)9-13(10-15(17)24-6)11-22-18(21-5)23-12-16(25-7)19(2,3)4/h9-10,16H,8,11-12H2,1-7H3,(H2,21,22,23) |
| InChIKey | AXGYOVZLFSVCMN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|