C20H24ClF2N3O3 — CID 111864704
1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine (PubChem CID 111864704) has the molecular formula C20H24ClF2N3O3 and a molecular weight of 427.88 g/mol. Its IUPAC name is 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111864704 |
| Molecular Formula | C20H24ClF2N3O3 |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine |
| SMILES | CCOc1c(Cl)cc(CN/C(=N/C)NCc2ccccc2OC(F)F)cc1OC |
| InChI | InChI=1S/C20H24ClF2N3O3/c1-4-28-18-15(21)9-13(10-17(18)27-3)11-25-20(24-2)26-12-14-7-5-6-8-16(14)29-19(22)23/h5-10,19H,4,11-12H2,1-3H3,(H2,24,25,26) |
| InChIKey | MOWBHQVNUGAPGT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|