C23H28ClN5O2 — CID 111850512
1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111850512) has the molecular formula C23H28ClN5O2 and a molecular weight of 441.96 g/mol. Its IUPAC name is 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111850512 |
| Molecular Formula | C23H28ClN5O2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 1-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCOc1c(Cl)cc(CN/C(=N/C)NCc2ccccc2Cn2cccn2)cc1OC |
| InChI | InChI=1S/C23H28ClN5O2/c1-4-31-22-20(24)12-17(13-21(22)30-3)14-26-23(25-2)27-15-18-8-5-6-9-19(18)16-29-11-7-10-28-29/h5-13H,4,14-16H2,1-3H3,(H2,25,26,27) |
| InChIKey | MPXPKLSUQSXFLY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|