C23H28F2IN5O2 — CID 111852153
1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111852153) has the molecular formula C23H28F2IN5O2 and a molecular weight of 571.41 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111852153 |
| Molecular Formula | C23H28F2IN5O2 |
| Molecular Weight | 571.41 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCOc1cc(CN/C(=N/C)NCc2ccccc2Cn2cccn2)ccc1OC(F)F.I |
| InChI | InChI=1S/C23H27F2N5O2.HI/c1-3-31-21-13-17(9-10-20(21)32-22(24)25)14-27-23(26-2)28-15-18-7-4-5-8-19(18)16-30-12-6-11-29-30;/h4-13,22H,3,14-16H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | QEJGVMKDACQAQC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|