C21H24BrN5O — CID 111850870
1-[(3-bromo-4-methoxyphenyl)methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111850870) has the molecular formula C21H24BrN5O and a molecular weight of 442.36 g/mol. Its IUPAC name is 1-[(3-bromo-4-methoxyphenyl)methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111850870 |
| Molecular Formula | C21H24BrN5O |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(OC)c(Br)c1)NCc1ccccc1Cn1cccn1 |
| InChI | InChI=1S/C21H24BrN5O/c1-23-21(24-13-16-8-9-20(28-2)19(22)12-16)25-14-17-6-3-4-7-18(17)15-27-11-5-10-26-27/h3-12H,13-15H2,1-2H3,(H2,23,24,25) |
| InChIKey | ZHHXVAYNHAWCQS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|