C21H22ClN3O3 — CID 41419081
3-chloro-4-ethoxy-5-methoxy-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 41419081) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-5-methoxy-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 3-chloro-4-ethoxy-5-methoxy-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 41419081 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-chloro-4-ethoxy-5-methoxy-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)NCc2ccccc2Cn2cccn2)cc1OC |
| InChI | InChI=1S/C21H22ClN3O3/c1-3-28-20-18(22)11-17(12-19(20)27-2)21(26)23-13-15-7-4-5-8-16(15)14-25-10-6-9-24-25/h4-12H,3,13-14H2,1-2H3,(H,23,26) |
| InChIKey | LJARYDHDUSDERZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |