C19H31F2N3O3 — CID 111709587
1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine (PubChem CID 111709587) has the molecular formula C19H31F2N3O3 and a molecular weight of 387.47 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine.
| Compound Name | 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111709587 |
| Molecular Formula | C19H31F2N3O3 |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine |
| SMILES | CCOc1cc(CN/C(=N/C)NCC(OC)C(C)(C)C)ccc1OC(F)F |
| InChI | InChI=1S/C19H31F2N3O3/c1-7-26-15-10-13(8-9-14(15)27-17(20)21)11-23-18(22-5)24-12-16(25-6)19(2,3)4/h8-10,16-17H,7,11-12H2,1-6H3,(H2,22,23,24) |
| InChIKey | VXBHSAUEBZSBOI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|