C17H27F2N3O3 — CID 111605227
1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-3-(2-methoxy-2-methylpropyl)-2-methylguanidine (PubChem CID 111605227) has the molecular formula C17H27F2N3O3 and a molecular weight of 359.42 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-3-(2-methoxy-2-methylpropyl)-2-methylguanidine.
| Compound Name | 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-3-(2-methoxy-2-methylpropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111605227 |
| Molecular Formula | C17H27F2N3O3 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-3-(2-methoxy-2-methylpropyl)-2-methylguanidine |
| SMILES | CCOc1cc(CN/C(=N/C)NCC(C)(C)OC)ccc1OC(F)F |
| InChI | InChI=1S/C17H27F2N3O3/c1-6-24-14-9-12(7-8-13(14)25-15(18)19)10-21-16(20-4)22-11-17(2,3)23-5/h7-9,15H,6,10-11H2,1-5H3,(H2,20,21,22) |
| InChIKey | LYICVSXMUWCYCJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|