C15H20F5N3O2 — CID 109472223
1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109472223) has the molecular formula C15H20F5N3O2 and a molecular weight of 369.33 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109472223 |
| Molecular Formula | C15H20F5N3O2 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCOc1cc(CN/C(=N/C)NCCC(F)(F)F)ccc1OC(F)F |
| InChI | InChI=1S/C15H20F5N3O2/c1-3-24-12-8-10(4-5-11(12)25-13(16)17)9-23-14(21-2)22-7-6-15(18,19)20/h4-5,8,13H,3,6-7,9H2,1-2H3,(H2,21,22,23) |
| InChIKey | DSNSOBSBFZGWOI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|