C17H29N3O2 — CID 111710367
1-(2-methoxy-3,3-dimethylbutyl)-3-[(4-methoxyphenyl)methyl]-2-methylguanidine (PubChem CID 111710367) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 1-(2-methoxy-3,3-dimethylbutyl)-3-[(4-methoxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-(2-methoxy-3,3-dimethylbutyl)-3-[(4-methoxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111710367 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1-(2-methoxy-3,3-dimethylbutyl)-3-[(4-methoxyphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(OC)cc1)NCC(OC)C(C)(C)C |
| InChI | InChI=1S/C17H29N3O2/c1-17(2,3)15(22-6)12-20-16(18-4)19-11-13-7-9-14(21-5)10-8-13/h7-10,15H,11-12H2,1-6H3,(H2,18,19,20) |
| InChIKey | SJRPQNLTWGNKAT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|