C20H37IN4O3S — CID 111711370
1-(2-methoxy-3,3-dimethylbutyl)-2-methyl-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111711370) has the molecular formula C20H37IN4O3S and a molecular weight of 540.51 g/mol. Its IUPAC name is 1-(2-methoxy-3,3-dimethylbutyl)-2-methyl-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methoxy-3,3-dimethylbutyl)-2-methyl-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111711370 |
| Molecular Formula | C20H37IN4O3S |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 1-(2-methoxy-3,3-dimethylbutyl)-2-methyl-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N(C)C(C)C)cc1)NCC(OC)C(C)(C)C.I |
| InChI | InChI=1S/C20H36N4O3S.HI/c1-15(2)24(7)28(25,26)17-11-9-16(10-12-17)13-22-19(21-6)23-14-18(27-8)20(3,4)5;/h9-12,15,18H,13-14H2,1-8H3,(H2,21,22,23);1H |
| InChIKey | VJPJJVRXDNEEBU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|