C19H34N4O2S — CID 111890915
1-(2-ethylbutyl)-2-methyl-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine (PubChem CID 111890915) has the molecular formula C19H34N4O2S and a molecular weight of 382.57 g/mol. Its IUPAC name is 1-(2-ethylbutyl)-2-methyl-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine.
| Compound Name | 1-(2-ethylbutyl)-2-methyl-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111890915 |
| Molecular Formula | C19H34N4O2S |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 1-(2-ethylbutyl)-2-methyl-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine |
| SMILES | CCC(CC)CN/C(=N\C)NCc1ccc(S(=O)(=O)N(C)C(C)C)cc1 |
| InChI | InChI=1S/C19H34N4O2S/c1-7-16(8-2)13-21-19(20-5)22-14-17-9-11-18(12-10-17)26(24,25)23(6)15(3)4/h9-12,15-16H,7-8,13-14H2,1-6H3,(H2,20,21,22) |
| InChIKey | YPVLFOVIFORTHI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|