C20H36N4O3S — CID 111971608
2-methyl-1-[2-(3-methylbutoxy)ethyl]-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine (PubChem CID 111971608) has the molecular formula C20H36N4O3S and a molecular weight of 412.60 g/mol. Its IUPAC name is 2-methyl-1-[2-(3-methylbutoxy)ethyl]-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[2-(3-methylbutoxy)ethyl]-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111971608 |
| Molecular Formula | C20H36N4O3S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 2-methyl-1-[2-(3-methylbutoxy)ethyl]-3-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCOCCC(C)C)NCc1ccc(S(=O)(=O)N(C)C(C)C)cc1 |
| InChI | InChI=1S/C20H36N4O3S/c1-16(2)11-13-27-14-12-22-20(21-5)23-15-18-7-9-19(10-8-18)28(25,26)24(6)17(3)4/h7-10,16-17H,11-15H2,1-6H3,(H2,21,22,23) |
| InChIKey | OTQVDDPQURBHIL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|