C17H30IN3O3S — CID 111711246
1-(2-methoxy-3,3-dimethylbutyl)-2-methyl-3-[(4-methylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111711246) has the molecular formula C17H30IN3O3S and a molecular weight of 483.42 g/mol. Its IUPAC name is 1-(2-methoxy-3,3-dimethylbutyl)-2-methyl-3-[(4-methylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methoxy-3,3-dimethylbutyl)-2-methyl-3-[(4-methylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111711246 |
| Molecular Formula | C17H30IN3O3S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 1-(2-methoxy-3,3-dimethylbutyl)-2-methyl-3-[(4-methylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(C)(=O)=O)cc1)NCC(OC)C(C)(C)C.I |
| InChI | InChI=1S/C17H29N3O3S.HI/c1-17(2,3)15(23-5)12-20-16(18-4)19-11-13-7-9-14(10-8-13)24(6,21)22;/h7-10,15H,11-12H2,1-6H3,(H2,18,19,20);1H |
| InChIKey | IXIXJHIVCSMGJC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|