C19H26IN3O3S — CID 111169817
1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[(4-methylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111169817) has the molecular formula C19H26IN3O3S and a molecular weight of 503.41 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[(4-methylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[(4-methylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111169817 |
| Molecular Formula | C19H26IN3O3S |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[(4-methylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(OC)cc1)NCc1ccc(S(C)(=O)=O)cc1.I |
| InChI | InChI=1S/C19H25N3O3S.HI/c1-20-19(21-13-12-15-4-8-17(25-2)9-5-15)22-14-16-6-10-18(11-7-16)26(3,23)24;/h4-11H,12-14H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | KQEYHPQPEYVYNK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|