C19H25N3O3S — CID 111169818
1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[(4-methylsulfonylphenyl)methyl]guanidine (PubChem CID 111169818) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[(4-methylsulfonylphenyl)methyl]guanidine.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[(4-methylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111169818 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[(4-methylsulfonylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCCc1ccc(OC)cc1)NCc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-20-19(21-13-12-15-4-8-17(25-2)9-5-15)22-14-16-6-10-18(11-7-16)26(3,23)24/h4-11H,12-14H2,1-3H3,(H2,20,21,22) |
| InChIKey | GZZGUFJTNPXWMV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|