C14H23BrN4O2S — CID 111883485
tert-butyl N-[2-[[N-[(5-bromothiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate (PubChem CID 111883485) has the molecular formula C14H23BrN4O2S and a molecular weight of 391.34 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[(5-bromothiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-[(5-bromothiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111883485 |
| Molecular Formula | C14H23BrN4O2S |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | tert-butyl N-[2-[[N-[(5-bromothiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C14H23BrN4O2S/c1-14(2,3)21-13(20)18-8-7-17-12(16-4)19-9-10-5-6-11(15)22-10/h5-6H,7-9H2,1-4H3,(H,18,20)(H2,16,17,19) |
| InChIKey | HREOAHZWTAGBIQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|