C19H28BrNO5 — CID 56640944
[4-bromo-2-methoxy-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 56640944) has the molecular formula C19H28BrNO5 and a molecular weight of 430.34 g/mol. Its IUPAC name is [4-bromo-2-methoxy-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-bromo-2-methoxy-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 56640944 |
| Molecular Formula | C19H28BrNO5 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | [4-bromo-2-methoxy-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | COc1cc(Br)c(CCNC(=O)OC(C)(C)C)cc1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H28BrNO5/c1-18(2,3)16(22)25-15-10-12(13(20)11-14(15)24-7)8-9-21-17(23)26-19(4,5)6/h10-11H,8-9H2,1-7H3,(H,21,23) |
| InChIKey | HPMOAXITQIWHSS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|