C17H18BrNO4 — CID 27447138
(E)-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 27447138) has the molecular formula C17H18BrNO4 and a molecular weight of 380.24 g/mol. Its IUPAC name is (E)-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 27447138 |
| Molecular Formula | C17H18BrNO4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | (E)-N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | COc1cc(Br)c(CCNC(=O)/C=C/c2ccco2)cc1OC |
| InChI | InChI=1S/C17H18BrNO4/c1-21-15-10-12(14(18)11-16(15)22-2)7-8-19-17(20)6-5-13-4-3-9-23-13/h3-6,9-11H,7-8H2,1-2H3,(H,19,20)/b6-5+ |
| InChIKey | PQOADEIOVCRLDS-AATRIKPKSA-N |
| XLogP | 3.43 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|