C16H15F2NO4 — CID 9193821
(E)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 9193821) has the molecular formula C16H15F2NO4 and a molecular weight of 323.30 g/mol. Its IUPAC name is (E)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9193821 |
| Molecular Formula | C16H15F2NO4 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | (E)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | COc1cc(CNC(=O)/C=C/c2ccco2)ccc1OC(F)F |
| InChI | InChI=1S/C16H15F2NO4/c1-21-14-9-11(4-6-13(14)23-16(17)18)10-19-15(20)7-5-12-3-2-8-22-12/h2-9,16H,10H2,1H3,(H,19,20)/b7-5+ |
| InChIKey | SJKVRDMEHPSWAD-FNORWQNLSA-N |
| XLogP | 3.22 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|