C16H13Cl2NO4 — CID 20610054
methyl 2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoate (PubChem CID 20610054) has the molecular formula C16H13Cl2NO4 and a molecular weight of 354.19 g/mol. Its IUPAC name is methyl 2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoate.
| Compound Name | methyl 2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 20610054 |
| Molecular Formula | C16H13Cl2NO4 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | methyl 2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1c(Cl)cc(CNC(=O)/C=C/c2ccco2)cc1Cl |
| InChI | InChI=1S/C16H13Cl2NO4/c1-22-16(21)15-12(17)7-10(8-13(15)18)9-19-14(20)5-4-11-3-2-6-23-11/h2-8H,9H2,1H3,(H,19,20)/b5-4+ |
| InChIKey | KETXNFDAEUGOEH-SNAWJCMRSA-N |
| XLogP | 3.70 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|