C20H19Cl2N3O6 — CID 20768916
3-acetamido-2-[[2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoyl]amino]propanoic acid (PubChem CID 20768916) has the molecular formula C20H19Cl2N3O6 and a molecular weight of 468.29 g/mol. Its IUPAC name is 3-acetamido-2-[[2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-acetamido-2-[[2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20768916 |
| Molecular Formula | C20H19Cl2N3O6 |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 3-acetamido-2-[[2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoyl]amino]propanoic acid |
| SMILES | CC(=O)NCC(NC(=O)c1c(Cl)cc(CNC(=O)/C=C/c2ccco2)cc1Cl)C(=O)O |
| InChI | InChI=1S/C20H19Cl2N3O6/c1-11(26)23-10-16(20(29)30)25-19(28)18-14(21)7-12(8-15(18)22)9-24-17(27)5-4-13-3-2-6-31-13/h2-8,16H,9-10H2,1H3,(H,23,26)(H,24,27)(H,25,28)(H,29,30)/b5-4+ |
| InChIKey | SKRNCLUZEOFNRG-SNAWJCMRSA-N |
| XLogP | 2.24 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|