C15H11Cl2NO4 — CID 20610026
2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoic acid (PubChem CID 20610026) has the molecular formula C15H11Cl2NO4 and a molecular weight of 340.16 g/mol. Its IUPAC name is 2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoic acid.
| Compound Name | 2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 20610026 |
| Molecular Formula | C15H11Cl2NO4 |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2,6-dichloro-4-[[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]methyl]benzoic acid |
| SMILES | O=C(/C=C/c1ccco1)NCc1cc(Cl)c(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2NO4/c16-11-6-9(7-12(17)14(11)15(20)21)8-18-13(19)4-3-10-2-1-5-22-10/h1-7H,8H2,(H,18,19)(H,20,21)/b4-3+ |
| InChIKey | LLPLUDYDPLHWKY-ONEGZZNKSA-N |
| XLogP | 3.61 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|