C20H24N2O6 — CID 55616568
3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide (PubChem CID 55616568) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is 3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide.
| Compound Name | 3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 55616568 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N-[(3,4,5-trimethoxyphenyl)methyl]propanamide |
| SMILES | COc1cc(CNC(=O)CCNC(=O)/C=C/c2ccco2)cc(OC)c1OC |
| InChI | InChI=1S/C20H24N2O6/c1-25-16-11-14(12-17(26-2)20(16)27-3)13-22-19(24)8-9-21-18(23)7-6-15-5-4-10-28-15/h4-7,10-12H,8-9,13H2,1-3H3,(H,21,23)(H,22,24)/b7-6+ |
| InChIKey | QKLVDCBJRQXLSC-VOTSOKGWSA-N |
| XLogP | 2.14 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|