C24H30N2O4 — CID 76870607
3-[3-(furan-2-yl)prop-2-enoylamino]-N-[[1-(4-methoxyphenyl)cyclohexyl]methyl]propanamide (PubChem CID 76870607) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 3-[3-(furan-2-yl)prop-2-enoylamino]-N-[[1-(4-methoxyphenyl)cyclohexyl]methyl]propanamide.
| Compound Name | 3-[3-(furan-2-yl)prop-2-enoylamino]-N-[[1-(4-methoxyphenyl)cyclohexyl]methyl]propanamide |
|---|---|
| PubChem CID | 76870607 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 3-[3-(furan-2-yl)prop-2-enoylamino]-N-[[1-(4-methoxyphenyl)cyclohexyl]methyl]propanamide |
| SMILES | COc1ccc(C2(CNC(=O)CCNC(=O)C=Cc3ccco3)CCCCC2)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-29-20-9-7-19(8-10-20)24(14-3-2-4-15-24)18-26-23(28)13-16-25-22(27)12-11-21-6-5-17-30-21/h5-12,17H,2-4,13-16,18H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | YISJZLZMQDVTKD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|