C11H15NO3 — CID 6162293
(E)-3-(furan-2-yl)-N-(3-methoxypropyl)prop-2-enamide (PubChem CID 6162293) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-(3-methoxypropyl)prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-(3-methoxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 6162293 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-(3-methoxypropyl)prop-2-enamide |
| SMILES | COCCCNC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C11H15NO3/c1-14-8-3-7-12-11(13)6-5-10-4-2-9-15-10/h2,4-6,9H,3,7-8H2,1H3,(H,12,13)/b6-5+ |
| InChIKey | SPPPYBOWTMXZBX-AATRIKPKSA-N |
| XLogP | 1.45 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|