C19H23NO3 — CID 9482537
(E)-3-(furan-2-yl)-N-[3-(2,3,5-trimethylphenoxy)propyl]prop-2-enamide (PubChem CID 9482537) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[3-(2,3,5-trimethylphenoxy)propyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[3-(2,3,5-trimethylphenoxy)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 9482537 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[3-(2,3,5-trimethylphenoxy)propyl]prop-2-enamide |
| SMILES | Cc1cc(C)c(C)c(OCCCNC(=O)/C=C/c2ccco2)c1 |
| InChI | InChI=1S/C19H23NO3/c1-14-12-15(2)16(3)18(13-14)23-11-5-9-20-19(21)8-7-17-6-4-10-22-17/h4,6-8,10,12-13H,5,9,11H2,1-3H3,(H,20,21)/b8-7+ |
| InChIKey | DPWXDEYDOPBGAZ-BQYQJAHWSA-N |
| XLogP | 3.80 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|