C20H24N2O5 — CID 55891984
3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N-[2-(2-methoxyethoxy)-4-methylphenyl]propanamide (PubChem CID 55891984) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N-[2-(2-methoxyethoxy)-4-methylphenyl]propanamide.
| Compound Name | 3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N-[2-(2-methoxyethoxy)-4-methylphenyl]propanamide |
|---|---|
| PubChem CID | 55891984 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N-[2-(2-methoxyethoxy)-4-methylphenyl]propanamide |
| SMILES | COCCOc1cc(C)ccc1NC(=O)CCNC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C20H24N2O5/c1-15-5-7-17(18(14-15)27-13-12-25-2)22-20(24)9-10-21-19(23)8-6-16-4-3-11-26-16/h3-8,11,14H,9-10,12-13H2,1-2H3,(H,21,23)(H,22,24)/b8-6+ |
| InChIKey | FDPOAOVERAMXPW-SOFGYWHQSA-N |
| XLogP | 2.77 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|