C15H22N2O5 — CID 122076970
4-[[2-(2-methoxyethoxy)-4-methylphenyl]carbamoylamino]butanoic acid (PubChem CID 122076970) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is 4-[[2-(2-methoxyethoxy)-4-methylphenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[2-(2-methoxyethoxy)-4-methylphenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122076970 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-[[2-(2-methoxyethoxy)-4-methylphenyl]carbamoylamino]butanoic acid |
| SMILES | COCCOc1cc(C)ccc1NC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C15H22N2O5/c1-11-5-6-12(13(10-11)22-9-8-21-2)17-15(20)16-7-3-4-14(18)19/h5-6,10H,3-4,7-9H2,1-2H3,(H,18,19)(H2,16,17,20) |
| InChIKey | JBJHNUNLPVLRJB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|