C12H18N2O2 — CID 5054028
1-(2,4-dimethylphenyl)-3-(2-methoxyethyl)urea (PubChem CID 5054028) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-(2-methoxyethyl)urea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 5054028 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C12H18N2O2/c1-9-4-5-11(10(2)8-9)14-12(15)13-6-7-16-3/h4-5,8H,6-7H2,1-3H3,(H2,13,14,15) |
| InChIKey | INSFWUQIVSGGCP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|