C17H26N2O3 — CID 75526025
methyl 7-[(2,4-dimethylphenyl)carbamoylamino]heptanoate (PubChem CID 75526025) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is methyl 7-[(2,4-dimethylphenyl)carbamoylamino]heptanoate.
| Compound Name | methyl 7-[(2,4-dimethylphenyl)carbamoylamino]heptanoate |
|---|---|
| PubChem CID | 75526025 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | methyl 7-[(2,4-dimethylphenyl)carbamoylamino]heptanoate |
| SMILES | COC(=O)CCCCCCNC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C17H26N2O3/c1-13-9-10-15(14(2)12-13)19-17(21)18-11-7-5-4-6-8-16(20)22-3/h9-10,12H,4-8,11H2,1-3H3,(H2,18,19,21) |
| InChIKey | LGLINZUCVFUACA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|