C15H21FN2O3 — CID 86914045
methyl 6-[(3-fluoro-4-methylphenyl)carbamoylamino]hexanoate (PubChem CID 86914045) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is methyl 6-[(3-fluoro-4-methylphenyl)carbamoylamino]hexanoate.
| Compound Name | methyl 6-[(3-fluoro-4-methylphenyl)carbamoylamino]hexanoate |
|---|---|
| PubChem CID | 86914045 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | methyl 6-[(3-fluoro-4-methylphenyl)carbamoylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)Nc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C15H21FN2O3/c1-11-7-8-12(10-13(11)16)18-15(20)17-9-5-3-4-6-14(19)21-2/h7-8,10H,3-6,9H2,1-2H3,(H2,17,18,20) |
| InChIKey | KBBZROWDXZXMOP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|