C11H16N2O2 — CID 110675983
1-(2,5-dimethylphenyl)-3-(methoxymethyl)urea (PubChem CID 110675983) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-(methoxymethyl)urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-(methoxymethyl)urea |
|---|---|
| PubChem CID | 110675983 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-(methoxymethyl)urea |
| SMILES | COCNC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C11H16N2O2/c1-8-4-5-9(2)10(6-8)13-11(14)12-7-15-3/h4-6H,7H2,1-3H3,(H2,12,13,14) |
| InChIKey | XXGDZBAANRAGKS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|