C18H22N2O3 — CID 23762285
1-[(3,5-dimethoxyphenyl)methyl]-3-(2,5-dimethylphenyl)urea (PubChem CID 23762285) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)methyl]-3-(2,5-dimethylphenyl)urea.
| Compound Name | 1-[(3,5-dimethoxyphenyl)methyl]-3-(2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 23762285 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)methyl]-3-(2,5-dimethylphenyl)urea |
| SMILES | COc1cc(CNC(=O)Nc2cc(C)ccc2C)cc(OC)c1 |
| InChI | InChI=1S/C18H22N2O3/c1-12-5-6-13(2)17(7-12)20-18(21)19-11-14-8-15(22-3)10-16(9-14)23-4/h5-10H,11H2,1-4H3,(H2,19,20,21) |
| InChIKey | VFWDIHJZYHARAD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |