C18H22N2O3 — CID 108990551
1-(2,5-dimethylphenyl)-3-[2-(4-methoxyphenoxy)ethyl]urea (PubChem CID 108990551) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[2-(4-methoxyphenoxy)ethyl]urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[2-(4-methoxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 108990551 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[2-(4-methoxyphenoxy)ethyl]urea |
| SMILES | COc1ccc(OCCNC(=O)Nc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C18H22N2O3/c1-13-4-5-14(2)17(12-13)20-18(21)19-10-11-23-16-8-6-15(22-3)7-9-16/h4-9,12H,10-11H2,1-3H3,(H2,19,20,21) |
| InChIKey | CYPKXTSCZMRWOW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|