C18H21N3O3 — CID 60602931
4-methyl-3-[2-(4-methylphenoxy)ethylcarbamoylamino]benzamide (PubChem CID 60602931) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-methyl-3-[2-(4-methylphenoxy)ethylcarbamoylamino]benzamide.
| Compound Name | 4-methyl-3-[2-(4-methylphenoxy)ethylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 60602931 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-methyl-3-[2-(4-methylphenoxy)ethylcarbamoylamino]benzamide |
| SMILES | Cc1ccc(OCCNC(=O)Nc2cc(C(N)=O)ccc2C)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-12-3-7-15(8-4-12)24-10-9-20-18(23)21-16-11-14(17(19)22)6-5-13(16)2/h3-8,11H,9-10H2,1-2H3,(H2,19,22)(H2,20,21,23) |
| InChIKey | GKRIQTAPZHSVNT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|