C17H18ClN3O3 — CID 60602927
3-[2-(4-chlorophenoxy)ethylcarbamoylamino]-4-methylbenzamide (PubChem CID 60602927) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is 3-[2-(4-chlorophenoxy)ethylcarbamoylamino]-4-methylbenzamide.
| Compound Name | 3-[2-(4-chlorophenoxy)ethylcarbamoylamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 60602927 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-[2-(4-chlorophenoxy)ethylcarbamoylamino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(N)=O)cc1NC(=O)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-11-2-3-12(16(19)22)10-15(11)21-17(23)20-8-9-24-14-6-4-13(18)5-7-14/h2-7,10H,8-9H2,1H3,(H2,19,22)(H2,20,21,23) |
| InChIKey | AHYAVDGJKYCJIV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|