C18H18Cl2N2O4 — CID 112976758
methyl 4-chloro-3-[2-(4-chloro-3-methylphenoxy)ethylcarbamoylamino]benzoate (PubChem CID 112976758) has the molecular formula C18H18Cl2N2O4 and a molecular weight of 397.26 g/mol. Its IUPAC name is methyl 4-chloro-3-[2-(4-chloro-3-methylphenoxy)ethylcarbamoylamino]benzoate.
| Compound Name | methyl 4-chloro-3-[2-(4-chloro-3-methylphenoxy)ethylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 112976758 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | methyl 4-chloro-3-[2-(4-chloro-3-methylphenoxy)ethylcarbamoylamino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)NCCOc2ccc(Cl)c(C)c2)c1 |
| InChI | InChI=1S/C18H18Cl2N2O4/c1-11-9-13(4-6-14(11)19)26-8-7-21-18(24)22-16-10-12(17(23)25-2)3-5-15(16)20/h3-6,9-10H,7-8H2,1-2H3,(H2,21,22,24) |
| InChIKey | IBNWVKVUJJVZJE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|