C19H21ClN2O5 — CID 112973218
methyl 4-chloro-3-[2-(4-ethoxyphenoxy)ethylcarbamoylamino]benzoate (PubChem CID 112973218) has the molecular formula C19H21ClN2O5 and a molecular weight of 392.84 g/mol. Its IUPAC name is methyl 4-chloro-3-[2-(4-ethoxyphenoxy)ethylcarbamoylamino]benzoate.
| Compound Name | methyl 4-chloro-3-[2-(4-ethoxyphenoxy)ethylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 112973218 |
| Molecular Formula | C19H21ClN2O5 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | methyl 4-chloro-3-[2-(4-ethoxyphenoxy)ethylcarbamoylamino]benzoate |
| SMILES | CCOc1ccc(OCCNC(=O)Nc2cc(C(=O)OC)ccc2Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2O5/c1-3-26-14-5-7-15(8-6-14)27-11-10-21-19(24)22-17-12-13(18(23)25-2)4-9-16(17)20/h4-9,12H,3,10-11H2,1-2H3,(H2,21,22,24) |
| InChIKey | MYKHDFXIXZLATP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|