C19H23ClN2O5 — CID 112973111
1-(4-chloro-2,5-dimethoxyphenyl)-3-[2-(3-ethoxyphenoxy)ethyl]urea (PubChem CID 112973111) has the molecular formula C19H23ClN2O5 and a molecular weight of 394.86 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-[2-(3-ethoxyphenoxy)ethyl]urea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[2-(3-ethoxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112973111 |
| Molecular Formula | C19H23ClN2O5 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[2-(3-ethoxyphenoxy)ethyl]urea |
| SMILES | CCOc1cccc(OCCNC(=O)Nc2cc(OC)c(Cl)cc2OC)c1 |
| InChI | InChI=1S/C19H23ClN2O5/c1-4-26-13-6-5-7-14(10-13)27-9-8-21-19(23)22-16-12-17(24-2)15(20)11-18(16)25-3/h5-7,10-12H,4,8-9H2,1-3H3,(H2,21,22,23) |
| InChIKey | DBUULRSXEPPILS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|