C20H25ClN2O3 — CID 112972651
1-(4-chloro-2-methoxy-5-methylphenyl)-3-[2-(4-propan-2-ylphenoxy)ethyl]urea (PubChem CID 112972651) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is 1-(4-chloro-2-methoxy-5-methylphenyl)-3-[2-(4-propan-2-ylphenoxy)ethyl]urea.
| Compound Name | 1-(4-chloro-2-methoxy-5-methylphenyl)-3-[2-(4-propan-2-ylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112972651 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-(4-chloro-2-methoxy-5-methylphenyl)-3-[2-(4-propan-2-ylphenoxy)ethyl]urea |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)NCCOc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H25ClN2O3/c1-13(2)15-5-7-16(8-6-15)26-10-9-22-20(24)23-18-11-14(3)17(21)12-19(18)25-4/h5-8,11-13H,9-10H2,1-4H3,(H2,22,23,24) |
| InChIKey | OVZAABNWWGYHJX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|