C19H24N2O5 — CID 112975715
1-[2-(3,5-dimethoxyphenoxy)ethyl]-3-(4-ethoxyphenyl)urea (PubChem CID 112975715) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-[2-(3,5-dimethoxyphenoxy)ethyl]-3-(4-ethoxyphenyl)urea.
| Compound Name | 1-[2-(3,5-dimethoxyphenoxy)ethyl]-3-(4-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 112975715 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-[2-(3,5-dimethoxyphenoxy)ethyl]-3-(4-ethoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)NCCOc2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C19H24N2O5/c1-4-25-15-7-5-14(6-8-15)21-19(22)20-9-10-26-18-12-16(23-2)11-17(13-18)24-3/h5-8,11-13H,4,9-10H2,1-3H3,(H2,20,21,22) |
| InChIKey | JLPQDWDGDGPMMD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|