C18H21ClN2O4 — CID 52642986
1-[2-(4-chlorophenoxy)ethyl]-3-(3-ethoxy-4-methoxyphenyl)urea (PubChem CID 52642986) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-3-(3-ethoxy-4-methoxyphenyl)urea.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-3-(3-ethoxy-4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 52642986 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-3-(3-ethoxy-4-methoxyphenyl)urea |
| SMILES | CCOc1cc(NC(=O)NCCOc2ccc(Cl)cc2)ccc1OC |
| InChI | InChI=1S/C18H21ClN2O4/c1-3-24-17-12-14(6-9-16(17)23-2)21-18(22)20-10-11-25-15-7-4-13(19)5-8-15/h4-9,12H,3,10-11H2,1-2H3,(H2,20,21,22) |
| InChIKey | HXPMZMFEGVSECT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|