C21H19Cl2N3O3 — CID 60600852
1-[2-(4-chlorophenoxy)ethyl]-3-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]urea (PubChem CID 60600852) has the molecular formula C21H19Cl2N3O3 and a molecular weight of 432.31 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-3-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]urea.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]urea |
|---|---|
| PubChem CID | 60600852 |
| Molecular Formula | C21H19Cl2N3O3 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]urea |
| SMILES | O=C(NCCOc1ccc(Cl)cc1)Nc1ccc(OCc2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2N3O3/c22-15-4-7-18(8-5-15)28-12-11-25-21(27)26-16-6-9-20(19(23)13-16)29-14-17-3-1-2-10-24-17/h1-10,13H,11-12,14H2,(H2,25,26,27) |
| InChIKey | IBSPZXYFGCRZFH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|